For research use only. Not for therapeutic Use.
Tenofovir hydrate(Cat No.:I002586)is a nucleotide reverse transcriptase inhibitor (NRTI) used extensively in antiviral research, particularly against HIV and hepatitis B virus. This compound interferes with viral DNA synthesis by acting as a chain terminator during replication, making it a cornerstone in studying viral replication mechanisms. Tenofovir hydrate is also crucial in evaluating resistance mutations and drug efficacy in antiviral therapy development. With its stability and efficacy, Tenofovir hydrate supports research aimed at understanding nucleoside analog pharmacology and improving therapeutic strategies for chronic viral infections.
| CAS Number | 206184-49-8 |
| Synonyms | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid;hydrate |
| Molecular Formula | C9H16N5O5P |
| Purity | ≥95% |
| Target | HIV |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20C |
| IC50 | 0.5-2.2 uM (HIV-1); 1.6-4.9 uM (HIV-2) [1] |
| IUPAC Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid;hydrate |
| InChI | InChI=1S/C9H14N5O4P.H2O/c1-6(18-5-19(15,16)17)2-14-4-13-7-8(10)11-3-12-9(7)14;/h3-4,6H,2,5H2,1H3,(H2,10,11,12)(H2,15,16,17);1H2/t6-;/m1./s1 |
| InChIKey | PINIEAOMWQJGBW-FYZOBXCZSA-N |
| SMILES | C[C@H](CN1C=NC2=C(N=CN=C21)N)OCP(=O)(O)O.O |
| Reference | <p style=/line-height:25px/> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |