For research use only. Not for therapeutic Use.
Tectoridin is a naturally occurring isoflavone glycoside found in plants like Belamcanda chinensis, essential for advanced pharmacological and nutraceutical research. This compound is known for its potent antioxidant, anti-inflammatory, and hepatoprotective properties. Tectoridin plays a crucial role in studying liver health, cancer prevention, and metabolic disorders. Its unique bioactivity and high purity make it an invaluable tool for developing health supplements and therapeutic agents, contributing significantly to the advancement of natural medicine and wellness research.
CAS Number | 611-40-5 |
Molecular Formula | C22H22O11 |
Purity | ≥95% |
Target | Estrogen Receptor/ERR |
IUPAC Name | 5-hydroxy-3-(4-hydroxyphenyl)-6-methoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
InChI | InChI=1S/C22H22O11/c1-30-21-13(32-22-20(29)19(28)17(26)14(7-23)33-22)6-12-15(18(21)27)16(25)11(8-31-12)9-2-4-10(24)5-3-9/h2-6,8,14,17,19-20,22-24,26-29H,7H2,1H3/t14-,17-,19+,20-,22-/m1/s1 |
InChIKey | CNOURESJATUGPN-UDEBZQQRSA-N |
SMILES | COC1=C(C=C2C(=C1O)C(=O)C(=CO2)C3=CC=C(C=C3)O)OC4C(C(C(C(O4)CO)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |