For research use only. Not for therapeutic Use.
Tectol（Cat No.:I044897）is a naturally occurring dihydroisocoumarin compound isolated from various plant species, particularly within the Tectona genus, such as Tectona grandis (teak). It features a benzopyranone core with hydroxyl and methoxy substituents, contributing to its distinct chemical and biological properties. Tectol exhibits a range of pharmacological activities, including antimicrobial, antioxidant, and anti-inflammatory effects. Its ability to modulate oxidative stress and inhibit microbial growth makes it of interest in natural product research. Tectol is being investigated for its potential use in herbal therapies, cosmetics, and as a lead compound in drug development.
| CAS Number | 24449-39-6 |
| Synonyms | 5-(6-hydroxy-2,2-dimethylbenzo[h]chromen-5-yl)-2,2-dimethylbenzo[h]chromen-6-ol |
| Molecular Formula | C30H26O4 |
| Purity | ≥95% |
| IUPAC Name | 5-(6-hydroxy-2,2-dimethylbenzo[h]chromen-5-yl)-2,2-dimethylbenzo[h]chromen-6-ol |
| InChI | InChI=1S/C30H26O4/c1-29(2)15-13-21-23(25(31)17-9-5-7-11-19(17)27(21)33-29)24-22-14-16-30(3,4)34-28(22)20-12-8-6-10-18(20)26(24)32/h5-16,31-32H,1-4H3 |
| InChIKey | FVTJXDIACKJEPH-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C3=CC=CC=C3C(=C2C4=C(C5=CC=CC=C5C6=C4C=CC(O6)(C)C)O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
