For research use only. Not for therapeutic Use.
Tebufenozide (CAT: R013429) is an insect growth regulator used in agriculture as a selective pesticide. Its action target is the molting hormone receptor, crucial for insect development. Tebufenozide disrupts the normal molting process by interfering with this receptor, leading to the developmental arrest and death of insects. It exhibits insecticidal properties, specifically targeting the larval stage. As a widely used pesticide, Tebufenozide controls pests like caterpillars and Lepidoptera larvae, which pose threats to crops. Its selective nature makes it environmentally friendly, with minimal impact on non-target organisms, including beneficial insects and wildlife.
| CAS Number | 112410-23-8 |
| Synonyms | 3,5-Dimethyl-1-(1,1-dimethylethyl)-2-(4-ethylbenzoyl)hydrazide Benzoic Acid; 1-tert-Butyl-1-(3,5-dimethylbenzoyl)-2-(4-ethylbenzoyl)hydrazine; 3,5-Dimethylbenzoic Acid N-tert-Butyl-N-(4-ethylbenzoyl)hydrazide; Confirm; Mimic; Mimic 240LV; Mimic 700WP |
| Molecular Formula | C22H28N2O2 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | -20°C |
| IUPAC Name | N-tert-butyl-N/'-(4-ethylbenzoyl)-3,5-dimethylbenzohydrazide |
| InChI | InChI=1S/C22H28N2O2/c1-7-17-8-10-18(11-9-17)20(25)23-24(22(4,5)6)21(26)19-13-15(2)12-16(3)14-19/h8-14H,7H2,1-6H3,(H,23,25) |
| InChIKey | QYPNKSZPJQQLRK-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C(=O)NN(C(=O)C2=CC(=CC(=C2)C)C)C(C)(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |