For research use only. Not for therapeutic Use.
TCS1105（Cat No.:M130250）is a selective small-molecule inhibitor targeting the protein kinase CK1δ (casein kinase 1 delta), which plays a critical role in regulating various cellular processes, including circadian rhythm, DNA repair, and cell signaling. By inhibiting CK1δ, TCS1105 has shown potential in modulating pathways associated with cancer progression, neurodegenerative diseases, and circadian rhythm disorders. Preclinical studies suggest that TCS1105 can disrupt tumor growth and enhance the effectiveness of other treatments. Ongoing research is focused on evaluating its safety, efficacy, and clinical potential, particularly in oncology and neurodegenerative disease treatments.
| CAS Number | 185391-33-7 |
| Synonyms | N-[(4-fluorophenyl)methyl]-2-(1H-indol-3-yl)-2-oxoacetamide |
| Molecular Formula | C17H13FN2O2 |
| Purity | ≥95% |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-(1H-indol-3-yl)-2-oxoacetamide |
| InChI | InChI=1S/C17H13FN2O2/c18-12-7-5-11(6-8-12)9-20-17(22)16(21)14-10-19-15-4-2-1-3-13(14)15/h1-8,10,19H,9H2,(H,20,22) |
| InChIKey | VWCCHJFFYCGXFL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=O)C(=O)NCC3=CC=C(C=C3)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
