For research use only. Not for therapeutic Use.
TCO-PEG2-amine(CAT:I016613) is a heterobifunctional crosslinker featuring a trans-cyclooctene (TCO) group and a terminal primary amine, separated by a short PEG2 spacer. The TCO moiety enables rapid and highly selective bioorthogonal inverse electron-demand Diels–Alder (IEDDA) reactions with tetrazines, while the amine group allows covalent attachment to carboxyl or activated ester groups. The PEG2 linker improves solubility and provides flexibility with minimal steric hindrance, making it suitable for precise conjugation strategies. This reagent is widely applied in bioconjugation, drug delivery, imaging, and chemical biology research, enabling stable and efficient labeling in advanced biomedical and materials applications.
| CAS Number | 2141981-87-3 |
| Synonyms | [(4Z)-cyclooct-4-en-1-yl] N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate |
| Molecular Formula | C15H28N2O4 |
| Purity | ≥95% |
| IUPAC Name | [(4Z)-cyclooct-4-en-1-yl] N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate |
| InChI | InChI=1S/C15H28N2O4/c16-8-10-19-12-13-20-11-9-17-15(18)21-14-6-4-2-1-3-5-7-14/h1-2,14H,3-13,16H2,(H,17,18)/b2-1- |
| InChIKey | XCPPYCGUCZZMQS-UPHRSURJSA-N |
| SMILES | C1CC=CCCC(C1)OC(=O)NCCOCCOCCN |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
