1. Home
  2. Product
  3. Inhibitors/Agonists
  4. Tavilermide

Tavilermide - CAS 263251-78-1

Tavilermide (CAT: I009720) is a nerve growth factor (NGF) mimetic. It is designed to mimic the biological activity of NGF, a protein that plays a critical role in the growth and survival of nerve cells. By acting as an NGF mimetic, tavilermide can bind to and activate the same receptors as NGF, promoting nerve cell growth, differentiation, and survival. This pharmacological action of tavilermide makes it a potential therapeutic agent for conditions involving nerve damage or degeneration, such as neurodegenerative diseases and peripheral neuropathies.

Catalog Number: I009720

CAS Number: 263251-78-1

PubChem Substance ID:355036147

Molecular Formula: C24H32N6O11

Molecular Weight:580.55

Purity: ≥95%

Online inquiry

* For research use only. Not for human or veterinary use.

Synonym

SynonymsTavilermide;3-((4S,7S,10S)-7-(4-aminobutyl)-4-((carboxymethyl)carbamoyl)-14-nitro-6,9,12-trioxo-3,4,5,6,7,8,9,10,11,12-decahydro-2H-benzo[b][1]oxa[5,8,11]triazacyclotetradecin-10-yl)propanoic acid

Property

Molecular Formula: C24H32N6O11
Molecular Weight580.55
SolubilitySoluble in DMSO, not in water
Purity≥95%
Storage0 - 4 °C for short term, or -20 °C for long term

Computed Descriptor

SMILESO=C(O)CC[C@H](N1)C(N[C@@H](CCCCN)C(N[C@H](C(NCC(O)=O)=O)CCOC2=CC=C([N+]([O-])=O)C=C2C1=O)=O)=O