For research use only. Not for therapeutic Use.
Tauro-obeticholic Acid (CAT: I017316) is the taurine-conjugated form of obeticholic acid (OCA), a potent farnesoid X receptor (FXR) agonist. As a bile acid derivative, it plays a key role in regulating bile acid synthesis, lipid metabolism, and glucose homeostasis. Tauro-obeticholic acid is widely used in preclinical studies to investigate cholestatic liver diseases, nonalcoholic steatohepatitis (NASH), and metabolic disorders. Conjugation with taurine improves solubility and mimics physiologically relevant bile acid conjugates, making it highly useful for studying enterohepatic circulation, FXR signaling pathways, and gut–liver axis interactions. It is a valuable tool in hepatology and metabolic disease research.
| CAS Number | 863239-61-6 |
| Synonyms | 2-[[(4R)-4-[(3R,5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid |
| Molecular Formula | C28H49NO6S |
| Purity | ≥95% |
| IUPAC Name | 2-[[(4R)-4-[(3R,5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid |
| InChI | InChI=1S/C28H49NO6S/c1-5-19-23-16-18(30)10-12-28(23,4)22-11-13-27(3)20(7-8-21(27)25(22)26(19)32)17(2)6-9-24(31)29-14-15-36(33,34)35/h17-23,25-26,30,32H,5-16H2,1-4H3,(H,29,31)(H,33,34,35)/t17-,18-,19-,20-,21+,22+,23+,25+,26-,27-,28-/m1/s1 |
| InChIKey | JEZXQTZLWHAKAC-NQGMLVFVSA-N |
| SMILES | CCC1C2CC(CCC2(C3CCC4(C(C3C1O)CCC4C(C)CCC(=O)NCCS(=O)(=O)O)C)C)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
