For research use only. Not for therapeutic Use.
Tartaric Acid Isopropyl Ester(CAT: R050745) is a chemical compound often utilized as a reactant or intermediate in various organic syntheses. Its mode of action involves its role as a component in chemical reactions, potentially contributing to the production of a wide range of organic compounds. While its specific pharmacologic actions and applications are not explicitly documented, compounds like this are vital in synthetic chemistry, where they serve as building blocks for more complex molecules.
| CAS Number | 116601-09-3 |
| Synonyms | L-Tartaric Acid Isopropyl Ester; |
| Molecular Formula | C7H12O6 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2R,3R)-2,3-dihydroxy-4-oxo-4-propan-2-yloxybutanoic acid |
| InChI | InChI=1S/C7H12O6/c1-3(2)13-7(12)5(9)4(8)6(10)11/h3-5,8-9H,1-2H3,(H,10,11)/t4-,5-/m1/s1 |
| InChIKey | SSZYZSRPAKZEIB-RFZPGFLSSA-N |
| SMILES | CC(C)OC(=O)C(C(C(=O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |