For research use only. Not for therapeutic Use.
TAN-452（Cat No.:I036994）is a synthetic small-molecule compound investigated for its potential antiplatelet and antithrombotic activities. It functions primarily as an inhibitor of platelet aggregation by targeting specific pathways involved in thrombus formation, such as the thromboxane A2 or ADP signaling cascade. TAN-452 has been evaluated in preclinical models for its ability to reduce the risk of arterial thrombosis without significantly increasing bleeding time, a common limitation of conventional antiplatelet therapies. Its favorable pharmacokinetic profile and targeted action make it a promising candidate for further development in cardiovascular and thrombotic disorder treatments.
| CAS Number | 892039-23-5 |
| Synonyms | ethyl (1S,2S,13R,21R)-22-(cyclopropylmethyl)-2,16-dihydroxy-14-oxa-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5(10),6,8,15,17,19(25)-heptaene-8-carboxylate |
| Molecular Formula | C29H30N2O5 |
| Purity | ≥95% |
| IUPAC Name | ethyl (1S,2S,13R,21R)-22-(cyclopropylmethyl)-2,16-dihydroxy-14-oxa-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5(10),6,8,15,17,19(25)-heptaene-8-carboxylate |
| InChI | InChI=1S/C29H30N2O5/c1-2-35-27(33)17-5-7-18-19-13-29(34)22-12-16-6-8-21(32)25-23(16)28(29,9-10-31(22)14-15-3-4-15)26(36-25)24(19)30-20(18)11-17/h5-8,11,15,22,26,30,32,34H,2-4,9-10,12-14H2,1H3/t22-,26+,28+,29-/m1/s1 |
| InChIKey | JOJGLAWHRDFWNQ-KFDULEKRSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)C3=C(N2)[C@H]4[C@@]56CCN([C@@H]([C@@]5(C3)O)CC7=C6C(=C(C=C7)O)O4)CC8CC8 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
