For research use only. Not for therapeutic Use.
Takeda103A（Cat No.:I036964）is a potent inhibitor designed to target specific proteins involved in cell signaling pathways, with particular focus on kinases that regulate cancer cell growth and survival. By blocking these key kinases, Takeda103A disrupts critical processes such as cell division, apoptosis, and metastasis in cancer cells. This compound shows significant promise in oncology, particularly for tumors that are resistant to conventional therapies. Takeda103A’s selective action makes it a valuable tool for studying cancer biology and developing targeted therapies for various types of cancer, including solid tumors and hematologic malignancies.
| CAS Number | 865609-72-9 |
| Synonyms | N-[(2,6-difluorophenyl)methyl]-3-[(4-propyl-5-pyrimidin-4-yl-1,2,4-triazol-3-yl)methylamino]benzamide |
| Molecular Formula | C24H23F2N7O |
| Purity | ≥95% |
| IUPAC Name | N-[(2,6-difluorophenyl)methyl]-3-[(4-propyl-5-pyrimidin-4-yl-1,2,4-triazol-3-yl)methylamino]benzamide |
| InChI | InChI=1S/C24H23F2N7O/c1-2-11-33-22(31-32-23(33)21-9-10-27-15-30-21)14-28-17-6-3-5-16(12-17)24(34)29-13-18-19(25)7-4-8-20(18)26/h3-10,12,15,28H,2,11,13-14H2,1H3,(H,29,34) |
| InChIKey | VWBSMGFTNCQOMB-UHFFFAOYSA-N |
| SMILES | CCCN1C(=NN=C1C2=NC=NC=C2)CNC3=CC=CC(=C3)C(=O)NCC4=C(C=CC=C4F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
