For research use only. Not for therapeutic Use.
(-)-Tabersonine(CAT: R050341) is a naturally occurring indole alkaloid (C₂₁H₂₄N₂O₂) extracted primarily from plants of the Apocynaceae family, such as Catharanthus roseus. It serves as a key biosynthetic precursor to several medically important vinca alkaloids, including vinblastine and vincristine, which are used in cancer chemotherapy. Structurally, it features a complex polycyclic framework incorporating an indole core, contributing to its biological activity. In research, (-)-Tabersonine is studied for its role in alkaloid biosynthetic pathways, as well as for potential pharmacological properties such as anticancer and antimicrobial effects. Its rarity and synthetic complexity make it valuable in both natural products chemistry and drug development.
| CAS Number | 4429-63-4 |
| Synonyms | (5α,12R,19α)-2,3,6,7-Tetradehydroaspidospermidine-3-carboxylic Acid Methyl Ester; 3a-Ethyl-3a,4,6,11,12,13a-hexahydro-1H-indolizino[8,1-cd]carbazole-5-carboxylic Acid Methyl Ester; Tabersonine; Tabersonin; |
| Molecular Formula | C21H24N2O2 |
| Purity | ≥95% |
| Target | Amyloid-β |
| Storage | Store at -20°C |
| IUPAC Name | methyl (1R,12R,19S)-12-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,9,13-pentaene-10-carboxylate |
| InChI | InChI=1S/C21H24N2O2/c1-3-20-9-6-11-23-12-10-21(19(20)23)15-7-4-5-8-16(15)22-17(21)14(13-20)18(24)25-2/h4-9,19,22H,3,10-13H2,1-2H3/t19-,20-,21-/m0/s1 |
| InChIKey | FNGGIPWAZSFKCN-ACRUOGEOSA-N |
| SMILES | CCC12CC(=C3C4(C1N(CC4)CC=C2)C5=CC=CC=C5N3)C(=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
