For research use only. Not for therapeutic Use.
T01-1(Cat No.:I042755)is a selective small molecule inhibitor designed to target specific enzymes or proteins involved in cellular processes, particularly in the context of cancer and other diseases. It has shown promise in preclinical studies for its ability to disrupt critical signaling pathways that regulate cell growth, survival, and apoptosis. By inhibiting these pathways, T01-1 may help to reduce tumor growth and enhance the efficacy of existing cancer treatments. Researchers are exploring its potential as a targeted therapeutic agent for various malignancies, with the goal of improving patient outcomes in oncology.
| CAS Number | 2356229-14-4 |
| Synonyms | N-[2-[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]ethyl]-N-propan-2-ylmethanesulfonamide |
| Molecular Formula | C26H29N3O6S |
| Purity | ≥95% |
| IUPAC Name | N-[2-[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]ethyl]-N-propan-2-ylmethanesulfonamide |
| InChI | InChI=1S/C26H29N3O6S/c1-5-26(32)20-12-22-23-18(13-28(22)24(30)19(20)14-35-25(26)31)16(17-8-6-7-9-21(17)27-23)10-11-29(15(2)3)36(4,33)34/h6-9,12,15,32H,5,10-11,13-14H2,1-4H3/t26-/m0/s1 |
| InChIKey | PGWIUEMZGPWFBB-SANMLTNESA-N |
| SMILES | CC[C@@]1(C2=C(COC1=O)C(=O)N3CC4=C(C5=CC=CC=C5N=C4C3=C2)CCN(C(C)C)S(=O)(=O)C)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |