For research use only. Not for therapeutic Use.
| CAS Number | 77-79-2 |
| Synonyms | Sulpholene; β-Sulfolene; 2,5-Dihydrothiophene dioxide; 2,5-Dihydrothiophene sulfone; 3-Sulfolene; Butadiene sulfone; NSC 48532; NSC 56373; 2,5-Dihydrothiophen-1,1-dioxide; 2,5-Dihydrothiophene 1,1-dioxide; 2,5-Dihydrothiophene S,S-dioxide; |
| Molecular Formula | C4H6O2S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,5-dihydrothiophene 1,1-dioxide |
| InChI | InChI=1S/C4H6O2S/c5-7(6)3-1-2-4-7/h1-2H,3-4H2 |
| InChIKey | MBDNRNMVTZADMQ-UHFFFAOYSA-N |
| SMILES | C1C=CCS1(=O)=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |