For research use only. Not for therapeutic Use.
Sudan Black B（Cat No.:R028593）is a synthetic dye commonly used in histology and cell biology to stain lipids, particularly in tissue samples and cell cultures. It binds to lipid-rich structures such as membranes, fat droplets, and myelin, providing a visual contrast in microscopic analysis. Sudan Black B is often used in studies of lipid metabolism, fat storage, and neurobiology, as it helps to identify lipid deposits and differentiate between tissue components. Additionally, it is used in the analysis of atherosclerotic plaques and various lipid-related diseases.
| CAS Number | 4197-25-5 |
| Synonyms | (2,2-dimethyl-1,3-dihydroperimidin-6-yl)-(4-phenyldiazenylnaphthalen-1-yl)diazene |
| Molecular Formula | C29H24N6 |
| Purity | ≥95% |
| IUPAC Name | (2,2-dimethyl-1,3-dihydroperimidin-6-yl)-(4-phenyldiazenylnaphthalen-1-yl)diazene |
| InChI | InChI=1S/C29H24N6/c1-29(2)30-26-14-8-13-22-25(17-18-27(31-29)28(22)26)35-34-24-16-15-23(20-11-6-7-12-21(20)24)33-32-19-9-4-3-5-10-19/h3-18,30-31H,1-2H3 |
| InChIKey | YCUVUDODLRLVIC-UHFFFAOYSA-N |
| SMILES | CC1(NC2=C3C(=C(C=C2)N=NC4=CC=C(C5=CC=CC=C54)N=NC6=CC=CC=C6)C=CC=C3N1)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
