For research use only. Not for therapeutic Use.
SU5208（Cat No.:I044501）is a small-molecule, multi-targeted tyrosine kinase inhibitor that selectively inhibits receptors involved in angiogenesis and tumor growth, including VEGFR, PDGFR, and c-Kit. By blocking these signaling pathways, SU5208 disrupts endothelial cell proliferation and vascular development, ultimately suppressing tumor angiogenesis and progression. It has been investigated for its antitumor potential in various solid tumors, particularly where abnormal receptor tyrosine kinase signaling drives malignancy. SU5208 demonstrates both anti-angiogenic and direct antitumor activity, making it a valuable agent in preclinical oncology research and a candidate for combination therapeutic strategies.
| CAS Number | 62540-08-3 |
| Synonyms | (3Z)-3-(thiophen-2-ylmethylidene)-1H-indol-2-one |
| Molecular Formula | C13H9NOS |
| Purity | ≥95% |
| IUPAC Name | 3-(thiophen-2-ylmethylidene)-1H-indol-2-one |
| InChI | InChI=1S/C13H9NOS/c15-13-11(8-9-4-3-7-16-9)10-5-1-2-6-12(10)14-13/h1-8H,(H,14,15) |
| InChIKey | QMTIIBUDOBNABZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC3=CC=CS3)C(=O)N2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
