For research use only. Not for therapeutic Use.
Streptazolin（Cat No.:I044107）is a natural product antibiotic isolated from Streptomyces species, notable for its unique azacyclopentene core structure and antimicrobial activity. It exhibits modest bacteriostatic effects, primarily against Gram-positive bacteria, and has drawn interest for its unusual chemical scaffold, which serves as a basis for synthetic modification and structure-activity relationship (SAR) studies. While its direct clinical application remains limited, streptazolin is valuable in natural product research and medicinal chemistry as a template for developing new bioactive molecules. It also aids in exploring biosynthetic pathways in antibiotic-producing microorganisms.
| CAS Number | 80152-07-4 |
| Synonyms | (4S,5S,6Z,11S)-6-ethylidene-5-hydroxy-3-oxa-1-azatricyclo[5.3.1.04,11]undec-7-en-2-one |
| Molecular Formula | C11H13NO3 |
| Purity | ≥95% |
| IUPAC Name | (4S,5S,6Z,11S)-6-ethylidene-5-hydroxy-3-oxa-1-azatricyclo[5.3.1.04,11]undec-7-en-2-one |
| InChI | InChI=1S/C11H13NO3/c1-2-6-7-4-3-5-12-8(7)10(9(6)13)15-11(12)14/h2,4,8-10,13H,3,5H2,1H3/b6-2-/t8-,9-,10-/m0/s1 |
| InChIKey | OJIUACOQFBQCDF-IKXJTIOISA-N |
| SMILES | C/C=C/1\[C@@H]([C@@H]2[C@@H]3C1=CCCN3C(=O)O2)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
