SR9009(Cat No.:I001464), also known as Stenabolic, is a synthetic compound that acts as an agonist of the Rev-ErbA protein. It influences the circadian rhythm and metabolic processes, enhancing endurance, reducing inflammation, and improving lipid and glucose metabolism. SR9009 is being researched for its potential to treat conditions such as obesity, diabetes, and cardiovascular diseases. Its ability to increase mitochondrial activity and promote energy expenditure makes it a promising candidate for improving physical performance and managing metabolic disorders, contributing to overall health and disease prevention.
Catalog Number | I001464 |
CAS Number | 1379686-30-2 |
Synonyms | SR-9009 |
Molecular Formula | C20H24ClN3O4S |
Purity | 95% |
Target | Nuclear Receptors |
Solubility | DMSO: ≥ 30 mg/mL |
Storage | Store at -20°C |
IC50 | 670 nM (Rev-ErbBα), 800 nM (Rev-ErbBβ) |
IUPAC Name | ethyl 3-[[(4-chlorophenyl)methyl-[(5-nitrothiophen-2-yl)methyl]amino]methyl]pyrrolidine-1-carboxylate |
InChI | InChI=1S/C20H24ClN3O4S/c1-2-28-20(25)23-10-9-16(13-23)12-22(11-15-3-5-17(21)6-4-15)14-18-7-8-19(29-18)24(26)27/h3-8,16H,2,9-14H2,1H3 |
InChIKey | MMJJNHOIVCGAAP-UHFFFAOYSA-N |
SMILES | CCOC(=O)N1CCC(C1)CN(CC2=CC=C(C=C2)Cl)CC3=CC=C(S3)[N+](=O)[O-] |