For research use only. Not for therapeutic Use.
SR7826（Cat No.:I011258）is a selective small-molecule inhibitor of p21-activated kinase 4 (PAK4), a serine/threonine kinase involved in cytoskeletal dynamics, cell proliferation, survival, and oncogenic signaling. By targeting PAK4, SR7826 disrupts downstream pathways such as PI3K/AKT and MAPK, impairing tumor growth and metastasis. It has been studied in cancer research as a potential therapeutic lead for solid tumors and hematological malignancies. Beyond oncology, SR7826 serves as a chemical probe to explore PAK4’s role in cell motility, adhesion, and developmental processes, aiding drug discovery and mechanistic signaling studies.
| CAS Number | 1219728-20-7 |
| Synonyms | 1-(2-hydroxyethyl)-3-[4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]-1-phenylurea |
| Molecular Formula | C22H21N5O2 |
| Purity | ≥95% |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]-1-phenylurea |
| InChI | InChI=1S/C22H21N5O2/c1-15-13-23-21-19(15)20(24-14-25-21)16-7-9-17(10-8-16)26-22(29)27(11-12-28)18-5-3-2-4-6-18/h2-10,13-14,28H,11-12H2,1H3,(H,26,29)(H,23,24,25) |
| InChIKey | WQAGVQVBDHOHRD-UHFFFAOYSA-N |
| SMILES | CC1=CNC2=NC=NC(=C12)C3=CC=C(C=C3)NC(=O)N(CCO)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
