For research use only. Not for therapeutic Use.
SR1664（Cat No.:I009578）is a selective modulator of peroxisome proliferator-activated receptor gamma (PPARγ) that improves insulin sensitivity without the adverse side effects associated with full agonists like thiazolidinediones. Unlike traditional PPARγ ligands, SR1664 blocks phosphorylation of PPARγ at serine 273—a modification linked to insulin resistance—without inducing classical transcriptional activation. This mechanism allows SR1664 to enhance glucose metabolism and insulin responsiveness while minimizing risks such as weight gain, fluid retention, and bone loss. SR1664 represents a promising therapeutic candidate for type 2 diabetes and metabolic syndrome with an improved safety profile.
| CAS Number | 1338259-05-4 |
| Synonyms | 2-[4-[[2,3-dimethyl-5-[[(1S)-1-(4-nitrophenyl)ethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoic acid |
| Molecular Formula | C33H29N3O5 |
| Purity | ≥95% |
| IUPAC Name | 2-[4-[[2,3-dimethyl-5-[[(1S)-1-(4-nitrophenyl)ethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoic acid |
| InChI | InChI=1S/C33H29N3O5/c1-20-22(3)35(19-23-8-10-25(11-9-23)28-6-4-5-7-29(28)33(38)39)31-17-14-26(18-30(20)31)32(37)34-21(2)24-12-15-27(16-13-24)36(40)41/h4-18,21H,19H2,1-3H3,(H,34,37)(H,38,39)/t21-/m0/s1 |
| InChIKey | IIJDFXNUWZTHIM-NRFANRHFSA-N |
| SMILES | CC1=C(N(C2=C1C=C(C=C2)C(=O)N[C@@H](C)C3=CC=C(C=C3)[N+](=O)[O-])CC4=CC=C(C=C4)C5=CC=CC=C5C(=O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
