Spliceostatin A (CAT: I009788) is a natural product derived from the bacterium Pseudomonas chartarum. It is a potent inhibitor of pre-mRNA splicing, a crucial step in gene expression. Spliceostatin A targets the spliceosome, a large ribonucleoprotein complex responsible for the removal of introns and the splicing together of exons during mRNA maturation. By inhibiting the spliceosome, spliceostatin A disrupts the splicing process and alters mRNA processing, leading to the accumulation of aberrant splicing products and ultimately affecting protein production. Due to its ability to modulate splicing, spliceostatin A has attracted interest in both basic research and potential therapeutic applications for diseases related to splicing dysregulation, such as cancer.
Catalog Number | I009788 |
CAS Number | 391611-36-2 |
Synonyms | Spliceostatin A; (2Z,4S)-4-(Acetyloxy)-N-[(2R,3R,5S,6S)-tetrahydro-6-[(2E,4E)-5-[(3R,4R,5R,7S)-4-hydroxy-7-methoxy-7-methyl-1,6-dioxaspiro[2.5]oct-5-yl]-3-methyl-2,4-pentadien-1-yl]-2,5-dimethyl-2H-pyran-3-yl]-2-pentenamide |
Molecular Formula | C28H43NO8 |
Purity | 95% |
Storage | Room temperature |
IUPAC Name | [(Z,2S)-5-[[(2R,3R,5S,6S)-6-[(2E,4E)-5-[(3R,4R,5R,7S)-4-hydroxy-7-methoxy-7-methyl-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
InChI | InChI=1S/C28H43NO8/c1-17(9-12-24-26(32)28(16-34-28)15-27(6,33-7)37-24)8-11-23-18(2)14-22(20(4)36-23)29-25(31)13-10-19(3)35-21(5)30/h8-10,12-13,18-20,22-24,26,32H,11,14-16H2,1-7H3,(H,29,31)/b12-9+,13-10-,17-8+/t18-,19-,20+,22+,23-,24+,26+,27-,28+/m0/s1 |
InChIKey | XKSGIJNRMWHQIQ-CGPJBNNXSA-N |
SMILES | CC1CC(C(OC1CC=C(C)C=CC2C(C3(CC(O2)(C)OC)CO3)O)C)NC(=O)C=CC(C)OC(=O)C |
Reference | 1: Yoshimoto R, Kaida D, Furuno M, Burroughs AM, Noma S, Suzuki H, Kawamura Y, <br> <br> 4: Ghosh AK, Chen ZH. Enantioselective syntheses of FR901464 and spliceostatin A: 5: Corrionero A, Miñana B, Valcárcel J. Reduced fidelity of branch point <br> <br> 8: Lo CW, Kaida D, Nishimura S, Matsuyama A, Yashiroda Y, Taoka H, Ishigami K, 9: Kaida D, Motoyoshi H, Tashiro E, Nojima T, Hagiwara M, Ishigami K, Watanabe H, |