For research use only. Not for therapeutic Use.
Sulfo-SPDP(CAT: I015285) is a water-soluble, cleavable ADC linker widely used in the synthesis of antibody-drug conjugates (ADCs) and other bioconjugates. It contains a cleavable disulfide bond that enables controlled drug release within the reductive intracellular environment. The sulfo-NHS ester group allows efficient and stable conjugation to primary amines on antibodies, proteins, or peptides, ensuring high solubility and biocompatibility. Sulfo-SPDP is particularly valuable in oncology research for developing targeted cancer therapies, facilitating precise drug delivery while minimizing off-target toxicity. Its cleavable nature ensures effective therapeutic payload release, enhancing ADC efficacy and safety profiles.
| CAS Number | 121115-30-8 |
| Molecular Formula | C₁₂H₁₂N₂O₇S₃ |
| Purity | ≥95% |
| Target | ADC Linker |
| IUPAC Name | 2,5-dioxo-1-[3-(pyridin-2-yldisulfanyl)propanoyloxy]pyrrolidine-3-sulfonic acid |
| InChI | InChI=1S/C12H12N2O7S3/c15-10-7-8(24(18,19)20)12(17)14(10)21-11(16)4-6-22-23-9-3-1-2-5-13-9/h1-3,5,8H,4,6-7H2,(H,18,19,20) |
| InChIKey | MRKXZYGMIDQTPG-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)N(C1=O)OC(=O)CCSSC2=CC=CC=N2)S(=O)(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |