For research use only. Not for therapeutic Use.
SPDB(Cat No.:I000558) is a cleavable linker commonly employed in the synthesis of antibody-drug conjugates (ADCs). It is designed to connect the antibody component of the ADC with the cytotoxic drug payload. SPDB contains a specific chemical bond that can be selectively cleaved under certain conditions, facilitating the release of the drug at the target site. This linker plays a crucial role in ADC development by providing stability during circulation and controlled drug release upon internalization by target cells, maximizing the therapeutic efficacy of the conjugate.
CAS Number | 115088-06-7 |
Molecular Formula | C13H14N2O4S2 |
Purity | ≥95% |
Target | ADC Linker |
Solubility | Disslove in DMSO |
Storage | -20°C |
IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(pyridin-2-yldisulfanyl)butanoate |
InChI | InChI=1S/C13H14N2O4S2/c16-11-6-7-12(17)15(11)19-13(18)5-3-9-20-21-10-4-1-2-8-14-10/h1-2,4,8H,3,5-7,9H2 |
InChIKey | JSHOVKSMJRQOGY-UHFFFAOYSA-N |
SMILES | C1CC(=O)N(C1=O)OC(=O)CCCSSC2=CC=CC=N2 |
Reference | <p style=/line-height:25px/> </p> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |