For research use only. Not for therapeutic Use.
SP-96（Cat No.:I045763）is a synthetic peptide inhibitor widely used in biomedical research. It is designed to interfere with specific protein–protein interactions, making it valuable in studying cellular signaling pathways, receptor binding, and disease mechanisms. Researchers utilize SP-96 to explore therapeutic strategies in areas such as cancer, immunology, and metabolic disorders. Its defined structure and stability enable reproducible results in experimental assays. By targeting selective molecular pathways, SP-96 provides insights into drug discovery and disease modeling, supporting the development of novel therapeutic approaches and precision medicine applications.
| CAS Number | 2682114-54-9 |
| Synonyms | 1-(3-fluorophenyl)-3-[3-[[7-(1-methylpyrazol-4-yl)quinazolin-4-yl]amino]phenyl]urea |
| Molecular Formula | C25H20FN7O |
| Purity | ≥95% |
| IUPAC Name | 1-(3-fluorophenyl)-3-[3-[[7-(1-methylpyrazol-4-yl)quinazolin-4-yl]amino]phenyl]urea |
| InChI | InChI=1S/C25H20FN7O/c1-33-14-17(13-29-33)16-8-9-22-23(10-16)27-15-28-24(22)30-20-6-3-7-21(12-20)32-25(34)31-19-5-2-4-18(26)11-19/h2-15H,1H3,(H,27,28,30)(H2,31,32,34) |
| InChIKey | CGDYRZUPKPBLND-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=CC3=C(C=C2)C(=NC=N3)NC4=CC(=CC=C4)NC(=O)NC5=CC(=CC=C5)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
