For research use only. Not for therapeutic Use.
SOS1-IN-11(Cat No.:I043873)is a selective small molecule inhibitor that targets SOS1 (Son of Sevenless 1), a guanine nucleotide exchange factor involved in activating RAS proteins, which are key regulators of cell signaling pathways responsible for cell growth, differentiation, and survival. By inhibiting SOS1, this compound disrupts RAS activation, potentially hindering the growth and survival of cancer cells that rely on RAS-driven signaling. SOS1-IN-11 shows promise as a therapeutic agent in oncology, particularly for cancers with mutations in RAS signaling pathways, offering a novel approach to targeting oncogenic RAS signaling.
| CAS Number | 2654741-64-5 |
| Synonyms | 4-methyl-N-[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]-7-morpholin-4-ylpyrido[3,4-d]pyridazin-1-amine |
| Molecular Formula | C22H24F3N5O |
| Purity | ≥95% |
| IUPAC Name | 4-methyl-N-[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]-7-morpholin-4-ylpyrido[3,4-d]pyridazin-1-amine |
| InChI | InChI=1S/C22H24F3N5O/c1-13-16(5-4-6-19(13)22(23,24)25)14(2)27-21-17-11-20(30-7-9-31-10-8-30)26-12-18(17)15(3)28-29-21/h4-6,11-12,14H,7-10H2,1-3H3,(H,27,29)/t14-/m1/s1 |
| InChIKey | RKWFDZPCFOPRML-CQSZACIVSA-N |
| SMILES | CC1=C(C=CC=C1C(F)(F)F)[C@@H](C)NC2=NN=C(C3=CN=C(C=C32)N4CCOCC4)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |