For research use only. Not for therapeutic Use.
Somniferine(Cat No.:M020725)is a bioactive compound derived from the plant Withania somnifera, commonly known as Ashwagandha. Renowned for its adaptogenic properties, Somniferine helps manage stress and anxiety by modulating cortisol levels and supporting adrenal function. It promotes restful sleep and improves overall sleep quality, making it valuable in addressing insomnia and other sleep disorders. Additionally, Somniferine exhibits neuroprotective effects, enhancing cognitive function and memory. Its role in traditional and modern herbal medicine highlights its importance in promoting mental well-being and overall health.
| CAS Number | 117611-63-9 |
| Synonyms | SOMNIFERINE |
| Molecular Formula | C36H36N2O7 |
| Purity | ≥95% |
| Storage | Desiccate at -20C |
| IUPAC Name | (4R,4aS,7aR,12bS)-6-[(2S,4R,7aR,12bS)-7,9-dimethoxy-3-methyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-2-yl]-4a,9-dihydroxy-3-methyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| InChI | InChI=1S/C36H36N2O7/c1-37-12-11-35-28-18-5-8-23(39)30(28)44-33(35)29(40)19(15-36(35,41)26(37)14-18)22-16-34-20-7-10-25(43-4)32(34)45-31-24(42-3)9-6-17(27(31)34)13-21(20)38(22)2/h5-10,15,21-22,26,32-33,39,41H,11-14,16H2,1-4H3/t21-,22+,26-,32+,33+,34+,35+,36-/m1/s1 |
| InChIKey | JQGBUIZIHWUPHT-CSVNJIPGSA-N |
| SMILES | CN1CCC23C4C(=O)C(=CC2(C1CC5=C3C(=C(C=C5)O)O4)O)C6CC78C9C(=CC=C7C(N6C)CC1=C8C(=C(C=C1)OC)O9)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |