For research use only. Not for therapeutic Use.
Solvent Yellow 114(CAT: M002055) is an azo dye commonly used as a colorant in various industrial applications. Its bright yellow hue makes it popular in coloring plastics, oils, waxes, and fuels, particularly in the aviation and automotive industries. Solvent Yellow 114 is oil-soluble, which allows it to be easily incorporated into non-polar organic solvents and hydrocarbons. Due to its strong color intensity and stability under heat and light, it is also used in inks, coatings, and some cosmetics. However, as an azo dye, it may raise environmental and safety concerns due to its potential to break down into aromatic amines, which are considered harmful.
CAS Number | 7576-65-0 |
Synonyms | 2-(3-hydroxyquinolin-2-yl)-1h-indene-1,3(2h)-dione;3/’-hydroxyquinophthalone;3-Hydroxyquinophthalone;disperse yellow e 2g;Disperse Yellow F 3G;dispersol fast yellow t 3g;kayaset yellow a-g;macrolex yellow g; Disperse Yellow 54 |
Molecular Formula | C18H11NO3 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 2-(3-hydroxyquinolin-2-yl)indene-1,3-dione |
InChI | InChI=1S/C18H11NO3/c20-14-9-10-5-1-4-8-13(10)19-16(14)15-17(21)11-6-2-3-7-12(11)18(15)22/h1-9,15,20H |
InChIKey | FDTLQXNAPKJJAM-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=C(C(=N2)C3C(=O)C4=CC=CC=C4C3=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |