Solutol HS 15 (Cat.No:M006834) is a nonionic surfactant and solubilizer used in pharmaceuticals, cosmetics, and other applications. Its amphiphilic nature enables improved solubility of hydrophobic compounds in aqueous solutions. Solutol HS 15 is utilized to enhance drug delivery, formulation stability, and bioavailability, making it valuable in various industries.
| Catalog Number | M006834 |
| CAS Number | 61909-81-7 |
| Synonyms | Solutol HS 15;Poly(oxy-1,2-ethanediyl), alpha-(12-hydroxy-1-oxooctadecyl)-omega-hydroxy- |
| Molecular Formula | C20H40O4 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | 2-hydroxyethyl 12-hydroxyoctadecanoate |
| InChI | InChI=1S/C20H40O4/c1-2-3-4-11-14-19(22)15-12-9-7-5-6-8-10-13-16-20(23)24-18-17-21/h19,21-22H,2-18H2,1H3 |
| InChIKey | JVKUCNQGESRUCL-UHFFFAOYSA-N |
| SMILES | CCCCCCC(CCCCCCCCCCC(=O)OCCO)O |
| Reference | <span style=”font-family:arial,helvetica,sans-serif;”><span style=”font-size:12px;”><span style=”color:#000000;”>1.</span><a href=”https://www.ncbi.nlm.nih.gov/pubmed/25190006″ rel=”nofollow” style=”color: rgb(122, 122, 122); text-decoration: none; line-height: 18px; font-family: Arial, -apple-system, sans-serif; font-variant-ligatures: normal; orphans: 2; text-align: justify; widows: 2;” target=”_blank”><span style=”color:#000000;”>Shubber S, et al. Mechanism of mucosal permeability enhancement of CriticalSorb? (Solutol? HS15) investigated in vitro in cell cultures. Pharm Res. 2015 Feb;32(2):516-27.</span></a></span></span> |
