For research use only. Not for therapeutic Use.
Solerole (Cat No.:C000743) is a naturally occurring organic compound with a distinctive tricyclic structure. It is found in certain plant species and has garnered interest for its potential biological activities. Solerole’s unique structure suggests its relevance in the field of natural product chemistry and drug discovery. Researchers likely investigate its pharmacological properties, which could encompass antimicrobial, anti-inflammatory, or other bioactive effects.
| CAS Number | 27610-27-1 |
| Synonyms | 4,5-Dihydroxyhexanoic Acid γ-Lactone; Dihydro-5-(1-hydroxyethyl)-2(3H)-furanone; |
| Molecular Formula | C₆H₁₀O₃ |
| Purity | ≥95% |
| Solubility | Chloroform (Sparingly), Methanol (Slightly) |
| Appearance | Colourless to Pale Yellow Oil |
| Storage | 4°C |
| IUPAC Name | 5-(1-hydroxyethyl)oxolan-2-one |
| InChI | InChI=1S/C6H10O3/c1-4(7)5-2-3-6(8)9-5/h4-5,7H,2-3H2,1H3 |
| InChIKey | KBLZKAKKJPDYKJ-UHFFFAOYSA-N |
| SMILES | CC(C1CCC(=O)O1)O |
| Reference | Woods, A.G.,et. al.: Biochem. Bioph. Res. Co., 419, 305 (2012); Samgina, T.Y., et. al.: J. Am. Soc. Mass Spec., 22, 2246 (2011) |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |