For research use only. Not for therapeutic Use.
Sodium Sulfadiazine(Cat No.:A000044)is a sulfonamide antibiotic used primarily in the treatment of bacterial infections, particularly those caused by susceptible Gram-positive and Gram-negative organisms. It inhibits bacterial dihydropteroate synthase, preventing the synthesis of folic acid, which is essential for bacterial growth. Sodium Sulfadiazine is commonly used in the treatment of urinary tract infections, meningitis, and certain parasitic diseases. It is often employed in combination with other antimicrobial agents to enhance efficacy and minimize resistance. This compound is essential in research focusing on antimicrobial resistance and drug development.
| CAS Number | 547-32-0 |
| Synonyms | ulfadiazin-natrium |
| Molecular Formula | C10H9N4NaO2S |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | Store at -20°C |
| IUPAC Name | sodium;(4-aminophenyl)sulfonyl-pyrimidin-2-ylazanide |
| InChI | InChI=1S/C10H9N4O2S.Na/c11-8-2-4-9(5-3-8)17(15,16)14-10-12-6-1-7-13-10;/h1-7H,11H2;/q-1;+1 |
| InChIKey | JLDCNMJPBBKAHH-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)[N-]S(=O)(=O)C2=CC=C(C=C2)N.[Na+] |
| Reference | <p>/Sulfadiazine: Mechanism of Action./ <em>Cancer News Network</em>. N.p., 2009. Web. 21 Aug. 2012.</p></span></p> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |