Sodium starch glycolate（Cat No.:R019941）, is a pharmaceutical excipient commonly used in the formulation of tablets and capsules. It serves as a super disintegrant, promoting the rapid disintegration of tablets when they come into contact with water or gastric fluids. This property is crucial for ensuring the efficient release of active pharmaceutical ingredients in the digestive system, enhancing drug absorption. Sodium starch glycolate is particularly valuable for oral drug delivery, where rapid and complete disintegration is essential for therapeutic effectiveness. Its use aids in improving the bioavailability and efficacy of various pharmaceutical products.
| Catalog Number | R019941 |
| CAS Number | 9063-38-1 |
| Synonyms | Carboxymethyl Starch Sodium Salt; Covagel; Crayon B 300P; Deprogel; Emsize CMS 100; Emsize CMS 60; Estarl A 100; Explosol; Explotab; Explotab CL-V; Expotab PCF; F 500 Papeal No. 50; Glycol YS; Glycolys LV; Glycolys Std; KMK-BUR 1; KMK-OK; Kiprogum F |
| Molecular Formula | C29H32N4O5 |
| Purity | 95% |
| Storage | Room Temperature |
| IUPAC Name | 19-ethyl-19-hydroxy-10-[2-(1-methylpiperidin-3-yl)ethoxyiminomethyl]-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
| InChI | InChI=1S/C29H32N4O5/c1-3-29(36)23-13-25-26-21(16-33(25)27(34)22(23)17-37-28(29)35)20(19-8-4-5-9-24(19)31-26)14-30-38-12-10-18-7-6-11-32(2)15-18/h4-5,8-9,13-14,18,36H,3,6-7,10-12,15-17H2,1-2H3 |
| InChIKey | XQGJJVUDKQCQFI-UHFFFAOYSA-N |
| SMILES | CCC1(C2=C(COC1=O)C(=O)N3CC4=C(C5=CC=CC=C5N=C4C3=C2)C=NOCCC6CCCN(C6)C)O |
