For research use only. Not for therapeutic Use.
Sodium Salicylate(CAT: I013883) is a non-steroidal anti-inflammatory drug (NSAID) that serves as a precursor to aspirin. It functions by inhibiting cyclooxygenase (COX) enzymes, reducing the production of prostaglandins involved in inflammation and pain. Additionally, it exhibits antipyretic and analgesic properties, making it valuable in inflammation and pain research. Sodium Salicylate is particularly significant in immunology research, where it is used to study inflammatory pathways and immune responses. Its versatility also extends to exploring cell signaling mechanisms, oxidative stress, and neuroprotection, providing a foundation for developing therapeutic strategies in inflammation-related diseases.
CAS Number | 54-21-7 |
Molecular Formula | C₇H₅NaO₃ |
Purity | ≥95% |
Target | COXAutophagy |
Solubility | H2O: ≥ 200 mg/mL |
IUPAC Name | sodium;2-hydroxybenzoate |
InChI | InChI=1S/C7H6O3.Na/c8-6-4-2-1-3-5(6)7(9)10;/h1-4,8H,(H,9,10);/q;+1/p-1 |
InChIKey | ABBQHOQBGMUPJH-UHFFFAOYSA-M |
SMILES | C1=CC=C(C(=C1)C(=O)[O-])O.[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |