For research use only. Not for therapeutic Use.
Sodium diethyldithiocarbamate(Cat No.:M070375)is a versatile chemical compound widely used in research and industrial applications, particularly in the fields of analytical chemistry and environmental science. It acts as a chelating agent, forming complexes with metals, which makes it valuable for metal ion analysis. In addition, it is used in the synthesis of rubber accelerators and as a reagent in the detection of heavy metals. Its ability to bind to metal ions allows for its application in decontamination processes and in the preparation of various metal derivatives for further chemical studies.
CAS Number | 148-18-5 |
Molecular Formula | (C2H5)2NCS2Na |
Purity | ≥95% |
Target | HIV |
Storage | -20°C |
IUPAC Name | sodium;N,N-diethylcarbamodithioate |
InChI | InChI=1S/C5H11NS2.Na/c1-3-6(4-2)5(7)8;/h3-4H2,1-2H3,(H,7,8);/q;+1/p-1 |
InChIKey | IOEJYZSZYUROLN-UHFFFAOYSA-M |
SMILES | CCN(CC)C(=S)[S-].[Na+] |
Reference | [1]. Evid Rep Technol Assess (Summ). 1999 Jan;(3):1-5.<br /> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |