For research use only. Not for therapeutic Use.
Sodium 4-amino-1-naphthalenesulfonate (Cat No.: M069165) is an aromatic sulfonated amine compound derived from naphthalene. This water-soluble, orange to reddish crystalline solid contains an amino group at the 4-position and a sulfonate group at the 1-position, making it reactive in diazotization and azo coupling reactions. It is primarily used as an intermediate in the synthesis of azo dyes, pigments, and fluorescent compounds. Its strong chromophoric properties and high solubility make it valuable in textile, ink, and analytical chemistry applications.
| CAS Number | 130-13-2 |
| Synonyms | Sodium naphthionate; sodium 4-aminonaphthalene-1-sulfonate; Sodium 4-amino-1-naphthalenesulfonate; Naphthemol |
| Molecular Formula | C10H8NNaO3S |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | sodium;4-aminonaphthalene-1-sulfonate |
| InChI | InChI=1S/C10H9NO3S.Na/c11-9-5-6-10(15(12,13)14)8-4-2-1-3-7(8)9;/h1-6H,11H2,(H,12,13,14);/q;+1/p-1 |
| InChIKey | JWSRMCCRAJUMLX-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2S(=O)(=O)[O-])N.[Na+] |
| Reference | <p> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |