For research use only. Not for therapeutic Use.
Sodium 2,2′-methylene-bis-(4,6-di-tert-butylphenyl)phosphate is a sterically hindered aromatic phosphate salt (Cat No.: M009914) used as an antioxidant and stabilizer in polymers and lubricants. Its bulky tert-butyl groups provide thermal stability and resistance to oxidation, protecting materials from degradation under heat and oxygen exposure. The phosphate functionality enhances compatibility with various polymer matrices. Common in plastics, elastomers, and synthetic lubricants, this compound extends product lifespan, preserves performance, and reduces discoloration, making it valuable in demanding industrial and automotive applications.
| CAS Number | 85209-91-2 |
| Synonyms | 12H-Dibenzo[d,g][1,3,2]dioxaphosphocin,2,4,8,10-tetrakis(1,1-dimethylethyl)-6-hydroxy-,6-oxide,sodiumsalt;12h-dibenzol[d,g][1,3,2]dioxaphosphocin,2,4,8,10-tetrakis(1,1-dimethylethyl)-6;12h-dibenzol[d,g][1,3,2]dioxaphosphocin,2,4,8,10-tetrakis(1,1-dim |
| Molecular Formula | C29H42NaO4P |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | sodium;1,3,7,9-tetratert-butyl-11-oxido-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide |
| InChI | InChI=1S/C29H43O4P.Na/c1-26(2,3)20-14-18-13-19-15-21(27(4,5)6)17-23(29(10,11)12)25(19)33-34(30,31)32-24(18)22(16-20)28(7,8)9;/h14-17H,13H2,1-12H3,(H,30,31);/q;+1/p-1 |
| InChIKey | ZHROMWXOTYBIMF-UHFFFAOYSA-M |
| SMILES | CC(C)(C)C1=CC(=C2C(=C1)CC3=CC(=CC(=C3OP(=O)(O2)[O-])C(C)(C)C)C(C)(C)C)C(C)(C)C.[Na+] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |