For research use only. Not for therapeutic Use.
Sodium 2-fluoroacrylate(Cat No.:L025139)is an organofluorine salt derived from 2-fluoroacrylic acid, featuring a fluorine atom on the vinyl group and a sodium counterion. It is primarily used as a monomer or comonomer in the synthesis of specialty polymers and copolymers, offering enhanced chemical resistance, hydrophobicity, and thermal stability. The presence of the electron-withdrawing fluorine atom influences polymerization behavior and final material properties. Sodium 2-fluoroacrylate is valuable in applications such as coatings, adhesives, and biomedical materials, where performance under harsh conditions or specific surface characteristics are required. Proper handling is necessary due to its reactive vinyl group.
| CAS Number | 74893-46-2 |
| Molecular Formula | C3H2FNaO2 |
| Purity | ≥95% |
| IUPAC Name | sodium;2-fluoroprop-2-enoate |
| InChI | InChI=1S/C3H3FO2.Na/c1-2(4)3(5)6;/h1H2,(H,5,6);/q;+1/p-1 |
| InChIKey | JGPFVCNXUUKNDS-UHFFFAOYSA-M |
| SMILES | C=C(C(=O)[O-])F.[Na+] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |