For research use only. Not for therapeutic Use.
Sodium 1-Heptanesulfonate (Cat.No:R036823) is a synthetic organic compound often used in chromatography, particularly in ion-exchange chromatography. It serves as a mobile phase additive or ion-pairing reagent to improve the separation of polar and charged compounds. This compound plays a crucial role in analytical chemistry for isolating and analyzing complex mixtures.
CAS Number | 22767-50-6 |
Synonyms | Sodium Heptylsulfonate; Sodium n-Heptylsulfonate; Heptylsulfonic Acid Sodium Salt?Sodium 1-Heptanesulfonate; |
Molecular Formula | C7H15NaO3S |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | sodium;heptane-1-sulfonate |
InChI | InChI=1S/C7H16O3S.Na/c1-2-3-4-5-6-7-11(8,9)10;/h2-7H2,1H3,(H,8,9,10);/q;+1/p-1 |
InChIKey | REFMEZARFCPESH-UHFFFAOYSA-M |
SMILES | CCCCCCCS(=O)(=O)[O-].[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |