For research use only. Not for therapeutic Use.
SOD1-Derlin-1 inhibitor-1(Cat No.:I036462)is a small molecule compound designed to target and inhibit the interaction between Superoxide Dismutase 1 (SOD1) and Derlin-1, two proteins involved in cellular stress responses and protein quality control. SOD1 is an antioxidant enzyme that helps protect cells from oxidative damage, while Derlin-1 plays a key role in the endoplasmic reticulum-associated degradation (ERAD) pathway. By disrupting the SOD1-Derlin-1 interaction, this inhibitor may modulate protein degradation and enhance cellular resilience, making it a promising candidate for treating diseases such as amyotrophic lateral sclerosis (ALS) and other neurodegenerative disorders.
| CAS Number | 840461-03-2 |
| Synonyms | 3-amino-N-(2,4-dibromophenyl)-6-pyridin-3-ylthieno[2,3-b]pyridine-2-carboxamide |
| Molecular Formula | C19H12Br2N4OS |
| Purity | ≥95% |
| IUPAC Name | 3-amino-N-(2,4-dibromophenyl)-6-pyridin-3-ylthieno[2,3-b]pyridine-2-carboxamide |
| InChI | InChI=1S/C19H12Br2N4OS/c20-11-3-5-15(13(21)8-11)24-18(26)17-16(22)12-4-6-14(25-19(12)27-17)10-2-1-7-23-9-10/h1-9H,22H2,(H,24,26) |
| InChIKey | WBPMNEHAAMMXEO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC3=C(C=C2)C(=C(S3)C(=O)NC4=C(C=C(C=C4)Br)Br)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |