For research use only. Not for therapeutic Use.
SNPB(Cat No.:I017805) is a cleavable linker commonly used in the construction of antibody-drug conjugates (ADCs). It acts as a connector between the antibody and the drug payload, allowing for targeted delivery of the drug to specific cells or tissues. SNPB is designed to be stable during circulation in the bloodstream but can be selectively cleaved at the target site, releasing the potent drug payload. This linker technology enhances the therapeutic efficacy and selectivity of ADCs in various disease applications, including cancer treatment.
CAS Number | 663598-85-4 |
Molecular Formula | C₁₃H₁₃N₃O₆S₂ |
Purity | ≥95% |
Target | ADC Linker |
IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[(5-nitropyridin-2-yl)disulfanyl]butanoate |
InChI | InChI=1S/C13H13N3O6S2/c17-11-5-6-12(18)15(11)22-13(19)2-1-7-23-24-10-4-3-9(8-14-10)16(20)21/h3-4,8H,1-2,5-7H2 |
InChIKey | WAXTZXRJMOUNSA-UHFFFAOYSA-N |
SMILES | C1CC(=O)N(C1=O)OC(=O)CCCSSC2=NC=C(C=C2)[N+](=O)[O-] |
Reference | [1]. Qiming Chen, et al. Anti-integrin immunoconjugates, methods and uses. WO2006062779A2. |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |