For research use only. Not for therapeutic Use.
SNC162（Cat No.:M040478）is a selective small molecule inhibitor targeting the sigma-1 receptor (σ1R), a protein involved in regulating cellular stress responses, ion homeostasis, and neuroprotection. By modulating sigma-1 receptor activity, SNC162 has shown potential in treating neurodegenerative disorders such as Alzheimer’s disease, Parkinson’s disease, and depression. It also plays a role in regulating calcium signaling, which is critical for neuronal function. SNC162’s neuroprotective effects and ability to stabilize cellular homeostasis make it a promising candidate for exploring therapeutic interventions in a variety of neurological conditions and diseases related to cellular stress.
| CAS Number | 178803-51-5 |
| Synonyms | 4-[(S)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-phenylmethyl]-N,N-diethylbenzamide |
| Molecular Formula | C27H37N3O |
| Purity | ≥95% |
| IUPAC Name | 4-[(S)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-phenylmethyl]-N,N-diethylbenzamide |
| InChI | InChI=1S/C27H37N3O/c1-6-18-29-19-22(5)30(20-21(29)4)26(23-12-10-9-11-13-23)24-14-16-25(17-15-24)27(31)28(7-2)8-3/h6,9-17,21-22,26H,1,7-8,18-20H2,2-5H3/t21-,22+,26+/m1/s1 |
| InChIKey | WGIDFDFAOQVAHY-UFPGJGBJSA-N |
| SMILES | CCN(CC)C(=O)C1=CC=C(C=C1)[C@H](C2=CC=CC=C2)N3C[C@H](N(C[C@@H]3C)CC=C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
