For research use only. Not for therapeutic Use.
SN40（Cat No.:I043556）is a small molecule inhibitor that targets the protein Src family kinases (SFKs), which are involved in regulating various cellular processes, including cell growth, survival, migration, and adhesion. SFKs are often upregulated in cancers, contributing to tumor progression, metastasis, and resistance to treatment. By inhibiting SFK activity, SN40 aims to block these pro-cancer signaling pathways, offering potential therapeutic benefits in oncology. It is being studied for its ability to reduce tumor cell proliferation and enhance the efficacy of existing cancer treatments, particularly in cancers where SFK activity is dysregulated.
| CAS Number | 2768663-14-3 |
| Synonyms | (2S,4S)-4-[(4-phenylphenyl)methylamino]pyrrolidine-2-carboxylic acid |
| Molecular Formula | C18H20N2O2 |
| Purity | ≥95% |
| IUPAC Name | (2S,4S)-4-[(4-phenylphenyl)methylamino]pyrrolidine-2-carboxylic acid |
| InChI | InChI=1S/C18H20N2O2/c21-18(22)17-10-16(12-20-17)19-11-13-6-8-15(9-7-13)14-4-2-1-3-5-14/h1-9,16-17,19-20H,10-12H2,(H,21,22)/t16-,17-/m0/s1 |
| InChIKey | FKDKNHWXEJUEMP-IRXDYDNUSA-N |
| SMILES | C1[C@@H](CN[C@@H]1C(=O)O)NCC2=CC=C(C=C2)C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
