For research use only. Not for therapeutic Use.
SMARCA-BD ligand 1 for PROTAC dihydrochloride（Cat No.:I018267）is a chemical probe designed to target the bromodomain of SMARCA proteins, key regulators in chromatin remodeling. As a functional ligand, it serves as a building block for PROTAC (Proteolysis Targeting Chimera) design, enabling selective degradation of SMARCA-associated proteins. By hijacking the ubiquitin–proteasome system, it supports studies of epigenetic regulation, transcriptional control, and cancer biology. The dihydrochloride salt form enhances solubility and handling, making it a valuable tool in chemical biology, drug discovery, and targeted protein degradation research.
| CAS Number | 2369053-68-7 |
| Synonyms | 2-(6-amino-5-piperazin-1-ylpyridazin-3-yl)phenol;dihydrochloride |
| Molecular Formula | C14H19Cl2N5O |
| Purity | ≥95% |
| IUPAC Name | 2-(6-amino-5-piperazin-1-ylpyridazin-3-yl)phenol;dihydrochloride |
| InChI | InChI=1S/C14H17N5O.2ClH/c15-14-12(19-7-5-16-6-8-19)9-11(17-18-14)10-3-1-2-4-13(10)20;;/h1-4,9,16,20H,5-8H2,(H2,15,18);2*1H |
| InChIKey | INBBYNMFULAIMY-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC(=NN=C2N)C3=CC=CC=C3O.Cl.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
