For research use only. Not for therapeutic Use.
SM-276001(CAT: I016419) is a potent and selective toll-like receptor 7 (TLR7) agonist with demonstrated immunostimulatory and antitumor properties. As an orally active compound, it functions as an interferon (IFN) inducer, triggering innate immune pathways that enhance antiviral and antitumor immune responses. By activating TLR7, SM-276001 promotes dendritic cell and macrophage activation, cytokine production, and the stimulation of adaptive immune mechanisms. This compound is widely studied in cancer immunotherapy, infectious disease models, and vaccine adjuvant research, where selective TLR7 activation plays a pivotal role in shaping host immunity and developing novel therapeutic strategies.
| CAS Number | 473930-22-2 |
| Synonyms | 6-amino-2-(butylamino)-9-[(6-methylpyridin-3-yl)methyl]-7H-purin-8-one |
| Molecular Formula | C16H21N7O |
| Purity | ≥95% |
| IUPAC Name | 6-amino-2-(butylamino)-9-[(6-methylpyridin-3-yl)methyl]-7H-purin-8-one |
| InChI | InChI=1S/C16H21N7O/c1-3-4-7-18-15-21-13(17)12-14(22-15)23(16(24)20-12)9-11-6-5-10(2)19-8-11/h5-6,8H,3-4,7,9H2,1-2H3,(H,20,24)(H3,17,18,21,22) |
| InChIKey | UEIOLEMXCBOQAX-UHFFFAOYSA-N |
| SMILES | CCCCNC1=NC(=C2C(=N1)N(C(=O)N2)CC3=CN=C(C=C3)C)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
