For research use only. Not for therapeutic Use.
SLU-PP-1072(CAT: I040910) is a dual inverse agonist targeting estrogen-related receptors alpha (ERRα) and gamma (ERRγ), which play significant roles in cellular metabolism and survival. By inhibiting these receptors, SLU-PP-1072 disrupts prostate cancer (PCa) cell metabolism, leading to alterations in energy production and dysregulation of key metabolic pathways. This disruption induces apoptosis and affects the cell cycle, ultimately inhibiting PCa cell growth. SLU-PP-1072 is a promising compound for prostate cancer research, offering potential as a therapeutic agent by targeting ERRα and ERRγ to disrupt metabolic processes critical to cancer cell survival.
| CAS Number | 2285432-57-5 |
| Synonyms | N-(1,3-benzothiazol-6-yl)-5-(4-hydroxyphenyl)furan-2-carboxamide |
| Molecular Formula | C18H12N2O3S |
| Purity | ≥95% |
| IUPAC Name | N-(1,3-benzothiazol-6-yl)-5-(4-hydroxyphenyl)furan-2-carboxamide |
| InChI | InChI=1S/C18H12N2O3S/c21-13-4-1-11(2-5-13)15-7-8-16(23-15)18(22)20-12-3-6-14-17(9-12)24-10-19-14/h1-10,21H,(H,20,22) |
| InChIKey | DYMDZGMAYKMYCT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(O2)C(=O)NC3=CC4=C(C=C3)N=CS4)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |