For research use only. Not for therapeutic Use.
Slingshot Inhibitor D3（Cat No.:I029779）is a small molecule inhibitor targeting Slingshot (SSH) phosphatases, particularly SSH-1, which regulate actin filament dynamics through cofilin dephosphorylation. By inhibiting Slingshot activity, D3 maintains cofilin in its phosphorylated, inactive state, thereby disrupting actin cytoskeleton remodeling. This effect is crucial in studying processes like cell migration, cancer metastasis, and neuronal development. D3 serves as a valuable tool in research focused on cytoskeletal dynamics and related signaling pathways. It has demonstrated efficacy in cellular models, making it suitable for exploring therapeutic targets involving actin regulation.
| CAS Number | 1715076-35-9 |
| Synonyms | 4-[[4-[(Z)-[3-(2-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| Molecular Formula | C25H19NO4S2 |
| Purity | ≥95% |
| IUPAC Name | 4-[[4-[(Z)-[3-(2-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| InChI | InChI=1S/C25H19NO4S2/c1-16-4-2-3-5-21(16)26-23(27)22(32-25(26)31)14-17-8-12-20(13-9-17)30-15-18-6-10-19(11-7-18)24(28)29/h2-14H,15H2,1H3,(H,28,29)/b22-14- |
| InChIKey | JZFBPGPPIJBVMI-HMAPJEAMSA-N |
| SMILES | CC1=CC=CC=C1N2C(=O)/C(=C/C3=CC=C(C=C3)OCC4=CC=C(C=C4)C(=O)O)/SC2=S |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
