Skyrin is a fungal metabolite characterized by a bisanthraquinone structure. It interferes with glucagon signaling through adenylate cyclase without binding to the glucagon receptor. At 10 μM, skyrin reduces both glucagon-<wbr></wbr>stimulated cAMP production and glycogenolysis. It does not interfere with epinephrine or glucagon-<wbr></wbr>like peptide 1 effects on these parameters.
| Catalog Number | R063789 |
| CAS Number | 602-06-2 |
| Synonyms | Endothianin;Rhodophyscin |
| Molecular Formula | C30H18O10 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | 2,4,5-trihydroxy-7-methyl-1-(2,4,5-trihydroxy-7-methyl-9,10-dioxoanthracen-1-yl)anthracene-9,10-dione |
| InChI | InChI=1S/C30H18O10/c1-9-3-11-19(13(31)5-9)29(39)23-17(35)7-15(33)21(25(23)27(11)37)22-16(34)8-18(36)24-26(22)28(38)12-4-10(2)6-14(32)20(12)30(24)40/h3-8,31-36H,1-2H3 |
| InChIKey | MQSXZQXHIJMNAF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=O)C3=C(C(=CC(=C3C2=O)O)O)C4=C5C(=C(C=C4O)O)C(=O)C6=C(C=C(C=C6C5=O)C)O)O |
| Reference | 1.Parker, J.C.,McPherson, R.K.,Andrews, K.M., et al. Effects of skyrin, a receptor-selective glucagon antagonist, in rat and human hepatocytes. Diabetes 49, 2079-2086 (2012). |
