For research use only. Not for therapeutic Use.
SKA-111（Cat No.:I036342）is a selective small molecule inhibitor that targets the mitotic spindle checkpoint, a critical component in cell division. By inhibiting this pathway, SKA-111 disrupts the proper segregation of chromosomes during mitosis, leading to mitotic errors and cell death. This mechanism makes SKA-111 a promising candidate for cancer therapy, particularly in cancers with dysregulated cell division. Preclinical studies have shown that SKA-111 can reduce tumor growth and sensitize cancer cells to other therapies. Ongoing research aims to further investigate its efficacy, safety, and potential for use in clinical cancer treatments.
| CAS Number | 1369170-24-0 |
| Synonyms | 5-methylbenzo[e][1,3]benzothiazol-2-amine |
| Molecular Formula | C12H10N2S |
| Purity | ≥95% |
| IUPAC Name | 5-methylbenzo[e][1,3]benzothiazol-2-amine |
| InChI | InChI=1S/C12H10N2S/c1-7-6-10-11(14-12(13)15-10)9-5-3-2-4-8(7)9/h2-6H,1H3,(H2,13,14) |
| InChIKey | JQZQMZXXJFFVFE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C3=CC=CC=C13)N=C(S2)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
