For research use only. Not for therapeutic Use.
SIRT1-IN-3（Cat No.:I043675）is a selective small molecule inhibitor of SIRT1 (Sirtuin 1), an NAD+-dependent deacetylase involved in regulating various cellular processes, including metabolism, aging, DNA repair, and inflammation. By inhibiting SIRT1, SIRT1-IN-3 can modulate cellular pathways related to aging and disease, particularly in conditions like cancer, neurodegenerative diseases, and metabolic disorders. The compound shows potential in restoring cellular homeostasis by influencing gene expression and protein acetylation. SIRT1-IN-3 is being explored as a therapeutic agent to target age-related diseases and diseases driven by SIRT1 activity dysregulation.
| CAS Number | 2470969-91-4 |
| Synonyms | 2-(5-bromo-3-propan-2-yl-1H-indol-2-yl)acetamide |
| Molecular Formula | C13H15BrN2O |
| Purity | ≥95% |
| IUPAC Name | 2-(5-bromo-3-propan-2-yl-1H-indol-2-yl)acetamide |
| InChI | InChI=1S/C13H15BrN2O/c1-7(2)13-9-5-8(14)3-4-10(9)16-11(13)6-12(15)17/h3-5,7,16H,6H2,1-2H3,(H2,15,17) |
| InChIKey | VBWIUUXBNGYYGO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(NC2=C1C=C(C=C2)Br)CC(=O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
