For research use only. Not for therapeutic Use.
SIRT1-IN-2（Cat No.:I043676）is a selective small molecule inhibitor targeting SIRT1 (Sirtuin 1), an enzyme involved in regulating cellular processes such as aging, metabolism, and stress response. By inhibiting SIRT1, SIRT1-IN-2 modulates key pathways linked to aging, inflammation, and disease progression. This compound has shown potential in preclinical studies for treating conditions such as neurodegenerative diseases, metabolic disorders, and certain cancers. By disrupting SIRT1’s activity, SIRT1-IN-2 could help correct cellular dysfunctions associated with these diseases, offering a promising approach for targeted therapies aimed at age-related and metabolic disorders.
| CAS Number | 2470969-89-0 |
| Synonyms | 2-(5-chloro-3-propan-2-yl-1H-indol-2-yl)acetamide |
| Molecular Formula | C13H15ClN2O |
| Purity | ≥95% |
| IUPAC Name | 2-(5-chloro-3-propan-2-yl-1H-indol-2-yl)acetamide |
| InChI | InChI=1S/C13H15ClN2O/c1-7(2)13-9-5-8(14)3-4-10(9)16-11(13)6-12(15)17/h3-5,7,16H,6H2,1-2H3,(H2,15,17) |
| InChIKey | IFPRJIBVYBLMFW-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(NC2=C1C=C(C=C2)Cl)CC(=O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
