For research use only. Not for therapeutic Use.
Simvastatin-d6 is a high-purity deuterated compound essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of simvastatin, featuring six deuterium atoms, is crucial for studies involving cholesterol metabolism, lipid-lowering mechanisms, and pharmacokinetics. Its stable isotope labeling ensures precise and reliable analytical results. With enhanced stability and consistency, it is suitable for various experimental setups. Ideal for cardiovascular research and drug development, Simvastatin-d6 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| CAS Number | 1002347-71-8 |
| Synonyms | 2,2-(Dimethyl-d6)butanoic Acid(1S,3R,7S,8S,8aR)-1,2,3,7,8,8a-hexahydro?-3,7-dimethyl-8-[2-[(2R,4R)-tetrahydro-4-hydroxy-6-oxo-2H-pyran-2-yl]ethyl]?-1-naphthalenyl Ester; (+)-Simvastatin-d6; Cholestat-d6; Lipex-d6; Novo-Simvastatin-d6; Simvotin-d6; Si |
| Molecular Formula | C25H38O5 |
| Purity | ≥95% |
| Target | Autophagy |
| Storage | 2°C to 8°C |
| IUPAC Name | [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-bis(trideuteriomethyl)butanoate |
| InChI | InChI=1S/C25H38O5/c1-6-25(4,5)24(28)30-21-12-15(2)11-17-8-7-16(3)20(23(17)21)10-9-19-13-18(26)14-22(27)29-19/h7-8,11,15-16,18-21,23,26H,6,9-10,12-14H2,1-5H3/t15-,16-,18+,19+,20-,21-,23-/m0/s1/i4D3,5D3 |
| InChIKey | RYMZZMVNJRMUDD-QDGXURMLSA-N |
| SMILES | [2H]C([2H])([2H])C(CC)(C(=O)O[C@H]1C[C@H](C=C2[C@H]1[C@H]([C@H](C=C2)C)CC[C@@H]3C[C@H](CC(=O)O3)O)C)C([2H])([2H])[2H] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |